C12H11BrN2O3S2 — CID 6502861
4-[(3-bromophenyl)sulfamoyl]-5-methylthiophene-2-carboxamide (PubChem CID 6502861) has the molecular formula C12H11BrN2O3S2 and a molecular weight of 375.27 g/mol. Its IUPAC name is 4-[(3-bromophenyl)sulfamoyl]-5-methylthiophene-2-carboxamide.
| Compound Name | 4-[(3-bromophenyl)sulfamoyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6502861 |
| Molecular Formula | C12H11BrN2O3S2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 4-[(3-bromophenyl)sulfamoyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(N)=O)cc1S(=O)(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H11BrN2O3S2/c1-7-11(6-10(19-7)12(14)16)20(17,18)15-9-4-2-3-8(13)5-9/h2-6,15H,1H3,(H2,14,16) |
| InChIKey | IDWCIPQFGNSFFG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |