C25H30N2O7S2 — CID 25060735
4-methoxy-1-N,3-N-bis(2-propoxyphenyl)benzene-1,3-disulfonamide (PubChem CID 25060735) has the molecular formula C25H30N2O7S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-methoxy-1-N,3-N-bis(2-propoxyphenyl)benzene-1,3-disulfonamide.
| Compound Name | 4-methoxy-1-N,3-N-bis(2-propoxyphenyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 25060735 |
| Molecular Formula | C25H30N2O7S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 4-methoxy-1-N,3-N-bis(2-propoxyphenyl)benzene-1,3-disulfonamide |
| SMILES | CCCOc1ccccc1NS(=O)(=O)c1ccc(OC)c(S(=O)(=O)Nc2ccccc2OCCC)c1 |
| InChI | InChI=1S/C25H30N2O7S2/c1-4-16-33-22-12-8-6-10-20(22)26-35(28,29)19-14-15-24(32-3)25(18-19)36(30,31)27-21-11-7-9-13-23(21)34-17-5-2/h6-15,18,26-27H,4-5,16-17H2,1-3H3 |
| InChIKey | PQNXOCVRPQIPBM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |