C17H17N3O6S — CID 20913991
N-(2,5-dimethoxyphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 20913991) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 20913991 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-7-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cc3[nH]c(=O)c(=O)[nH]c3cc2C)c1 |
| InChI | InChI=1S/C17H17N3O6S/c1-9-6-11-12(19-17(22)16(21)18-11)8-15(9)27(23,24)20-13-7-10(25-2)4-5-14(13)26-3/h4-8,20H,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | GBXSCQLYSXYAHD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|