C18H18F4N2O3S — CID 47516560
N,N-diethyl-4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (PubChem CID 47516560) has the molecular formula C18H18F4N2O3S and a molecular weight of 418.41 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N,N-diethyl-4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 47516560 |
| Molecular Formula | C18H18F4N2O3S |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N,N-diethyl-4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18F4N2O3S/c1-3-24(4-2)17(25)12-5-7-13(8-6-12)23-28(26,27)14-9-10-16(19)15(11-14)18(20,21)22/h5-11,23H,3-4H2,1-2H3 |
| InChIKey | TWZGJIXAPNLXDF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |