C20H20ClN5O3S — CID 55765789
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-pyrazol-1-ylphenyl)piperidine-4-carboxamide (PubChem CID 55765789) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-pyrazol-1-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-pyrazol-1-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55765789 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-pyrazol-1-ylphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cccn2)c1)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C20H20ClN5O3S/c21-19-18(6-2-9-22-19)30(28,29)25-12-7-15(8-13-25)20(27)24-16-4-1-5-17(14-16)26-11-3-10-23-26/h1-6,9-11,14-15H,7-8,12-13H2,(H,24,27) |
| InChIKey | CESNUYNVOPFJLA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|