C24H32N4O5S2 — CID 5020019
1-(4-methylphenyl)sulfonyl-3-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)urea (PubChem CID 5020019) has the molecular formula C24H32N4O5S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 5020019 |
| Molecular Formula | C24H32N4O5S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N4O5S2/c1-19-8-10-20(11-9-19)34(30,31)26-24(29)25-22-18-21(35(32,33)28-16-6-3-7-17-28)12-13-23(22)27-14-4-2-5-15-27/h8-13,18H,2-7,14-17H2,1H3,(H2,25,26,29) |
| InChIKey | PDEBKYQFYOWWOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |