C20H28N4O5S — CID 55729415
2-nitro-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)cyclopropane-1-carboxamide (PubChem CID 55729415) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-nitro-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 2-nitro-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55729415 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-nitro-N-(2-piperidin-1-yl-5-piperidin-1-ylsulfonylphenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCCCC1)C1CC1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N4O5S/c25-20(16-14-19(16)24(26)27)21-17-13-15(30(28,29)23-11-5-2-6-12-23)7-8-18(17)22-9-3-1-4-10-22/h7-8,13,16,19H,1-6,9-12,14H2,(H,21,25) |
| InChIKey | UTHUCKNXVNGBFZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|