C23H28N4O5S — CID 6217657
(E)-N-[2-(butylamino)-5-pyrrolidin-1-ylsulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 6217657) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is (E)-N-[2-(butylamino)-5-pyrrolidin-1-ylsulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(butylamino)-5-pyrrolidin-1-ylsulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6217657 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (E)-N-[2-(butylamino)-5-pyrrolidin-1-ylsulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCCCNc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N4O5S/c1-2-3-13-24-21-11-10-20(33(31,32)26-14-4-5-15-26)17-22(21)25-23(28)12-9-18-7-6-8-19(16-18)27(29)30/h6-12,16-17,24H,2-5,13-15H2,1H3,(H,25,28)/b12-9+ |
| InChIKey | LVJAZVHJDVKXJO-FMIVXFBMSA-N |
| XLogP | 4.24 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|