C26H25ClN4O5S — CID 17092296
(E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17092296) has the molecular formula C26H25ClN4O5S and a molecular weight of 541.03 g/mol. Its IUPAC name is (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17092296 |
| Molecular Formula | C26H25ClN4O5S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3c(Cl)cccc3NC(=O)/C=C/c3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C26H25ClN4O5S/c1-19-8-11-22(12-9-19)37(35,36)30-16-14-29(15-17-30)26-23(27)6-3-7-24(26)28-25(32)13-10-20-4-2-5-21(18-20)31(33)34/h2-13,18H,14-17H2,1H3,(H,28,32)/b13-10+ |
| InChIKey | MVAXBPRBXSGEEA-JLHYYAGUSA-N |
| XLogP | 4.72 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|