C29H32ClN3O5S — CID 43913958
(E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 43913958) has the molecular formula C29H32ClN3O5S and a molecular weight of 570.11 g/mol. Its IUPAC name is (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43913958 |
| Molecular Formula | C29H32ClN3O5S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | (E)-N-[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2cccc(Cl)c2N2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C29H32ClN3O5S/c1-4-38-26-14-10-22(20-27(26)37-3)11-15-28(34)31-25-7-5-6-24(30)29(25)32-16-18-33(19-17-32)39(35,36)23-12-8-21(2)9-13-23/h5-15,20H,4,16-19H2,1-3H3,(H,31,34)/b15-11+ |
| InChIKey | FQFCSXWYFUQIKD-RVDMUPIBSA-N |
| XLogP | 5.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|