C27H29ClN4O4S2 — CID 17092007
N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 17092007) has the molecular formula C27H29ClN4O4S2 and a molecular weight of 573.14 g/mol. Its IUPAC name is N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17092007 |
| Molecular Formula | C27H29ClN4O4S2 |
| Molecular Weight | 573.14 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2N2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H29ClN4O4S2/c1-3-36-21-11-9-20(10-12-21)26(33)30-27(37)29-24-6-4-5-23(28)25(24)31-15-17-32(18-16-31)38(34,35)22-13-7-19(2)8-14-22/h4-14H,3,15-18H2,1-2H3,(H2,29,30,33,37) |
| InChIKey | IMIPHFAQUJZQIE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|