C26H27ClN4O4S2 — CID 17091998
N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17091998) has the molecular formula C26H27ClN4O4S2 and a molecular weight of 559.11 g/mol. Its IUPAC name is N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17091998 |
| Molecular Formula | C26H27ClN4O4S2 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2N2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27ClN4O4S2/c1-18-6-12-21(13-7-18)37(33,34)31-16-14-30(15-17-31)24-22(27)4-3-5-23(24)28-26(36)29-25(32)19-8-10-20(35-2)11-9-19/h3-13H,14-17H2,1-2H3,(H2,28,29,32,36) |
| InChIKey | SBYQCQBBCPECHN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|