C25H24BrClN4O3S2 — CID 17091987
3-bromo-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17091987) has the molecular formula C25H24BrClN4O3S2 and a molecular weight of 607.98 g/mol. Its IUPAC name is 3-bromo-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17091987 |
| Molecular Formula | C25H24BrClN4O3S2 |
| Molecular Weight | 607.98 g/mol |
| Exact Mass | 606.02 |
| IUPAC Name | 3-bromo-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3c(Cl)cccc3NC(=S)NC(=O)c3cccc(Br)c3)CC2)cc1 |
| InChI | InChI=1S/C25H24BrClN4O3S2/c1-17-8-10-20(11-9-17)36(33,34)31-14-12-30(13-15-31)23-21(27)6-3-7-22(23)28-25(35)29-24(32)18-4-2-5-19(26)16-18/h2-11,16H,12-15H2,1H3,(H2,28,29,32,35) |
| InChIKey | QYNGEHDTHBQNOG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.98 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|