C26H26Cl2N4O3S2 — CID 17091981
3-chloro-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methylbenzamide (PubChem CID 17091981) has the molecular formula C26H26Cl2N4O3S2 and a molecular weight of 577.56 g/mol. Its IUPAC name is 3-chloro-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 17091981 |
| Molecular Formula | C26H26Cl2N4O3S2 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | 3-chloro-N-[[3-chloro-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3c(Cl)cccc3NC(=S)NC(=O)c3ccc(C)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C26H26Cl2N4O3S2/c1-17-6-10-20(11-7-17)37(34,35)32-14-12-31(13-15-32)24-21(27)4-3-5-23(24)29-26(36)30-25(33)19-9-8-18(2)22(28)16-19/h3-11,16H,12-15H2,1-2H3,(H2,29,30,33,36) |
| InChIKey | VGCAQHKEZVQVFV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|