C21H23BrClN3O2S — CID 3546622
3-bromo-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-ethoxybenzamide (PubChem CID 3546622) has the molecular formula C21H23BrClN3O2S and a molecular weight of 496.86 g/mol. Its IUPAC name is 3-bromo-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 3546622 |
| Molecular Formula | C21H23BrClN3O2S |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 3-bromo-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2N2CCCCC2)cc1Br |
| InChI | InChI=1S/C21H23BrClN3O2S/c1-2-28-18-10-9-14(13-15(18)22)20(27)25-21(29)24-17-8-6-7-16(23)19(17)26-11-4-3-5-12-26/h6-10,13H,2-5,11-12H2,1H3,(H2,24,25,27,29) |
| InChIKey | WDXNSVVQPQUKSD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|