C21H22Cl2N4O3 — CID 5213193
N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide (PubChem CID 5213193) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5213193 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
| SMILES | CCN1CCN(c2c(Cl)cccc2NC(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H22Cl2N4O3/c1-2-25-10-12-26(13-11-25)21-17(23)4-3-5-18(21)24-20(28)9-7-15-6-8-16(22)19(14-15)27(29)30/h3-9,14H,2,10-13H2,1H3,(H,24,28) |
| InChIKey | PBJJUSPOTTWNTR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|