C25H25Cl2N3O2 — CID 4997463
N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 4997463) has the molecular formula C25H25Cl2N3O2 and a molecular weight of 470.40 g/mol. Its IUPAC name is N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4997463 |
| Molecular Formula | C25H25Cl2N3O2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCN1CCN(c2c(Cl)cccc2NC(=O)C=Cc2ccc(-c3ccc(Cl)cc3)o2)CC1 |
| InChI | InChI=1S/C25H25Cl2N3O2/c1-2-29-14-16-30(17-15-29)25-21(27)4-3-5-22(25)28-24(31)13-11-20-10-12-23(32-20)18-6-8-19(26)9-7-18/h3-13H,2,14-17H2,1H3,(H,28,31) |
| InChIKey | IIIUVGPOSMURDB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|