C30H35N7O7 — CID 46281284
tert-butyl 4-[1-(4-nitrophenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 46281284) has the molecular formula C30H35N7O7 and a molecular weight of 605.65 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-nitrophenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-nitrophenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46281284 |
| Molecular Formula | C30H35N7O7 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | tert-butyl 4-[1-(4-nitrophenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2c(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cnn2-c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C30H35N7O7/c1-30(2,3)44-29(39)34-14-12-21(13-15-34)27-26(20-31-35(27)23-6-10-25(11-7-23)37(42)43)28(38)33-18-16-32(17-19-33)22-4-8-24(9-5-22)36(40)41/h4-11,20-21H,12-19H2,1-3H3 |
| InChIKey | MKKIDKFLRIJABF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 157.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|