C31H38N6O6 — CID 46350610
tert-butyl 4-[1-(4-methoxyphenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 46350610) has the molecular formula C31H38N6O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-methoxyphenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-methoxyphenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46350610 |
| Molecular Formula | C31H38N6O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | tert-butyl 4-[1-(4-methoxyphenyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(-n2ncc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C31H38N6O6/c1-31(2,3)43-30(39)35-15-13-22(14-16-35)28-27(21-32-36(28)24-9-11-26(42-4)12-10-24)29(38)34-19-17-33(18-20-34)23-5-7-25(8-6-23)37(40)41/h5-12,21-22H,13-20H2,1-4H3 |
| InChIKey | KPGARWVFIQODCK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 123.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|