C31H38ClN5O4 — CID 46280465
tert-butyl 4-[1-(4-chlorophenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 46280465) has the molecular formula C31H38ClN5O4 and a molecular weight of 580.13 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-chlorophenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-chlorophenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46280465 |
| Molecular Formula | C31H38ClN5O4 |
| Molecular Weight | 580.13 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | tert-butyl 4-[1-(4-chlorophenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)c3cnn(-c4ccc(Cl)cc4)c3C3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H38ClN5O4/c1-31(2,3)41-30(39)36-15-13-22(14-16-36)28-27(21-33-37(28)25-7-5-23(32)6-8-25)29(38)35-19-17-34(18-20-35)24-9-11-26(40-4)12-10-24/h5-12,21-22H,13-20H2,1-4H3 |
| InChIKey | VMVUQGZHPABIKM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.13 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|