C27H28F4N4O4 — CID 46281236
tert-butyl 4-[1-(4-methoxyphenyl)-4-[(2,3,5,6-tetrafluorophenyl)carbamoyl]pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 46281236) has the molecular formula C27H28F4N4O4 and a molecular weight of 548.54 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-methoxyphenyl)-4-[(2,3,5,6-tetrafluorophenyl)carbamoyl]pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-methoxyphenyl)-4-[(2,3,5,6-tetrafluorophenyl)carbamoyl]pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46281236 |
| Molecular Formula | C27H28F4N4O4 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | tert-butyl 4-[1-(4-methoxyphenyl)-4-[(2,3,5,6-tetrafluorophenyl)carbamoyl]pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(-n2ncc(C(=O)Nc3c(F)c(F)cc(F)c3F)c2C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H28F4N4O4/c1-27(2,3)39-26(37)34-11-9-15(10-12-34)24-18(14-32-35(24)16-5-7-17(38-4)8-6-16)25(36)33-23-21(30)19(28)13-20(29)22(23)31/h5-8,13-15H,9-12H2,1-4H3,(H,33,36) |
| InChIKey | RXOYJCIMYQFMQU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|