C32H41NO4 — CID 170705659
6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 170705659) has the molecular formula C32H41NO4 and a molecular weight of 503.68 g/mol. Its IUPAC name is 6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 170705659 |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 6-cyclohexyl-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | COC(OC)C1CCN(c2ccc(C3=C(C4CCCCC4)CCCc4cc(C(=O)O)ccc43)cc2)CC1 |
| InChI | InChI=1S/C32H41NO4/c1-36-32(37-2)24-17-19-33(20-18-24)27-14-11-23(12-15-27)30-28(22-7-4-3-5-8-22)10-6-9-25-21-26(31(34)35)13-16-29(25)30/h11-16,21-22,24,32H,3-10,17-20H2,1-2H3,(H,34,35) |
| InChIKey | UEVUIJNYUFPBTQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|