C33H36N4O7 — CID 137365213
1-(3,5-dimethoxyphenyl)-3-[4-(3-methoxyphenoxy)-2-[(4-morpholin-4-ylanilino)methyl]phenoxy]urea (PubChem CID 137365213) has the molecular formula C33H36N4O7 and a molecular weight of 600.67 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[4-(3-methoxyphenoxy)-2-[(4-morpholin-4-ylanilino)methyl]phenoxy]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[4-(3-methoxyphenoxy)-2-[(4-morpholin-4-ylanilino)methyl]phenoxy]urea |
|---|---|
| PubChem CID | 137365213 |
| Molecular Formula | C33H36N4O7 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[4-(3-methoxyphenoxy)-2-[(4-morpholin-4-ylanilino)methyl]phenoxy]urea |
| SMILES | COc1cc(NC(=O)NOc2ccc(Oc3cccc(OC)c3)cc2CNc2ccc(N3CCOCC3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C33H36N4O7/c1-39-27-5-4-6-28(20-27)43-29-11-12-32(44-36-33(38)35-25-18-30(40-2)21-31(19-25)41-3)23(17-29)22-34-24-7-9-26(10-8-24)37-13-15-42-16-14-37/h4-12,17-21,34H,13-16,22H2,1-3H3,(H2,35,36,38) |
| InChIKey | KSWRVVHEJXYHKB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|