C13H18N4O3 — CID 143035483
(2E)-3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylidenebut-3-enamide (PubChem CID 143035483) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2E)-3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylidenebut-3-enamide.
| Compound Name | (2E)-3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylidenebut-3-enamide |
|---|---|
| PubChem CID | 143035483 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2E)-3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-hydrazinylidenebut-3-enamide |
| SMILES | C=C(N)/C(=N\N)C(=O)NCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H18N4O3/c1-8(14)12(17-15)13(18)16-7-9-4-5-10(19-2)6-11(9)20-3/h4-6H,1,7,14-15H2,2-3H3,(H,16,18)/b17-12+ |
| InChIKey | JRURQNGFKPESCX-SFQUDFHCSA-N |
| XLogP | 0.11 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|