C12H14ClFO3 — CID 55119715
2-[chloro-(5-fluoro-2-methoxyphenyl)methyl]-1,4-dioxane (PubChem CID 55119715) has the molecular formula C12H14ClFO3 and a molecular weight of 260.69 g/mol. Its IUPAC name is 2-[chloro-(5-fluoro-2-methoxyphenyl)methyl]-1,4-dioxane.
| Compound Name | 2-[chloro-(5-fluoro-2-methoxyphenyl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 55119715 |
| Molecular Formula | C12H14ClFO3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-[chloro-(5-fluoro-2-methoxyphenyl)methyl]-1,4-dioxane |
| SMILES | COc1ccc(F)cc1C(Cl)C1COCCO1 |
| InChI | InChI=1S/C12H14ClFO3/c1-15-10-3-2-8(14)6-9(10)12(13)11-7-16-4-5-17-11/h2-3,6,11-12H,4-5,7H2,1H3 |
| InChIKey | RFYQGSWJAUHXQM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|