C12H13ClF2O2 — CID 79730638
2-[chloro-(2,4-difluoro-5-methylphenyl)methyl]-1,4-dioxane (PubChem CID 79730638) has the molecular formula C12H13ClF2O2 and a molecular weight of 262.68 g/mol. Its IUPAC name is 2-[chloro-(2,4-difluoro-5-methylphenyl)methyl]-1,4-dioxane.
| Compound Name | 2-[chloro-(2,4-difluoro-5-methylphenyl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 79730638 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[chloro-(2,4-difluoro-5-methylphenyl)methyl]-1,4-dioxane |
| SMILES | Cc1cc(C(Cl)C2COCCO2)c(F)cc1F |
| InChI | InChI=1S/C12H13ClF2O2/c1-7-4-8(10(15)5-9(7)14)12(13)11-6-16-2-3-17-11/h4-5,11-12H,2-3,6H2,1H3 |
| InChIKey | RXVMAPBEEADHHJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|