C14H15NO3 — CID 65350917
1,4-dioxan-2-yl(isoquinolin-5-yl)methanol (PubChem CID 65350917) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1,4-dioxan-2-yl(isoquinolin-5-yl)methanol.
| Compound Name | 1,4-dioxan-2-yl(isoquinolin-5-yl)methanol |
|---|---|
| PubChem CID | 65350917 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1,4-dioxan-2-yl(isoquinolin-5-yl)methanol |
| SMILES | OC(c1cccc2cnccc12)C1COCCO1 |
| InChI | InChI=1S/C14H15NO3/c16-14(13-9-17-6-7-18-13)12-3-1-2-10-8-15-5-4-11(10)12/h1-5,8,13-14,16H,6-7,9H2 |
| InChIKey | PGAWAOHLQVTNAU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |