C9H7BrF2O2 — CID 135370756
(2S)-2-bromo-2-(2,6-difluoro-4-methoxyphenyl)acetaldehyde (PubChem CID 135370756) has the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. Its IUPAC name is (2S)-2-bromo-2-(2,6-difluoro-4-methoxyphenyl)acetaldehyde.
| Compound Name | (2S)-2-bromo-2-(2,6-difluoro-4-methoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 135370756 |
| Molecular Formula | C9H7BrF2O2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | (2S)-2-bromo-2-(2,6-difluoro-4-methoxyphenyl)acetaldehyde |
| SMILES | COc1cc(F)c([C@H](Br)C=O)c(F)c1 |
| InChI | InChI=1S/C9H7BrF2O2/c1-14-5-2-7(11)9(6(10)4-13)8(12)3-5/h2-4,6H,1H3/t6-/m1/s1 |
| InChIKey | FNQLTJIGXNLAEW-ZCFIWIBFSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|