C15H21ClO2 — CID 65157754
2-[3-chloro-3-(4-methoxy-2-methylphenyl)propyl]oxolane (PubChem CID 65157754) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 2-[3-chloro-3-(4-methoxy-2-methylphenyl)propyl]oxolane.
| Compound Name | 2-[3-chloro-3-(4-methoxy-2-methylphenyl)propyl]oxolane |
|---|---|
| PubChem CID | 65157754 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[3-chloro-3-(4-methoxy-2-methylphenyl)propyl]oxolane |
| SMILES | COc1ccc(C(Cl)CCC2CCCO2)c(C)c1 |
| InChI | InChI=1S/C15H21ClO2/c1-11-10-13(17-2)5-7-14(11)15(16)8-6-12-4-3-9-18-12/h5,7,10,12,15H,3-4,6,8-9H2,1-2H3 |
| InChIKey | TUYYQKUJMAXMPE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|