C14H21ClOS — CID 81157629
2-[3-chloro-3-(3,5-dimethylthiophen-2-yl)propyl]oxane (PubChem CID 81157629) has the molecular formula C14H21ClOS and a molecular weight of 272.84 g/mol. Its IUPAC name is 2-[3-chloro-3-(3,5-dimethylthiophen-2-yl)propyl]oxane.
| Compound Name | 2-[3-chloro-3-(3,5-dimethylthiophen-2-yl)propyl]oxane |
|---|---|
| PubChem CID | 81157629 |
| Molecular Formula | C14H21ClOS |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[3-chloro-3-(3,5-dimethylthiophen-2-yl)propyl]oxane |
| SMILES | Cc1cc(C)c(C(Cl)CCC2CCCCO2)s1 |
| InChI | InChI=1S/C14H21ClOS/c1-10-9-11(2)17-14(10)13(15)7-6-12-5-3-4-8-16-12/h9,12-13H,3-8H2,1-2H3 |
| InChIKey | UCKFOMCCAYPVNS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|