C16H20Cl2O3 — CID 63951582
6-chloro-7-[1-chloro-3-(oxan-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 63951582) has the molecular formula C16H20Cl2O3 and a molecular weight of 331.24 g/mol. Its IUPAC name is 6-chloro-7-[1-chloro-3-(oxan-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-chloro-7-[1-chloro-3-(oxan-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 63951582 |
| Molecular Formula | C16H20Cl2O3 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-chloro-7-[1-chloro-3-(oxan-2-yl)propyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Clc1cc2c(cc1C(Cl)CCC1CCCCO1)OCCO2 |
| InChI | InChI=1S/C16H20Cl2O3/c17-13(5-4-11-3-1-2-6-19-11)12-9-15-16(10-14(12)18)21-8-7-20-15/h9-11,13H,1-8H2 |
| InChIKey | FEKBFIQOEWJYMI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|