C18H26ClFO — CID 81050009
(4-tert-butylcyclohexyl)-(2-chloro-4-fluoro-5-methylphenyl)methanol (PubChem CID 81050009) has the molecular formula C18H26ClFO and a molecular weight of 312.86 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-(2-chloro-4-fluoro-5-methylphenyl)methanol.
| Compound Name | (4-tert-butylcyclohexyl)-(2-chloro-4-fluoro-5-methylphenyl)methanol |
|---|---|
| PubChem CID | 81050009 |
| Molecular Formula | C18H26ClFO |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (4-tert-butylcyclohexyl)-(2-chloro-4-fluoro-5-methylphenyl)methanol |
| SMILES | Cc1cc(C(O)C2CCC(C(C)(C)C)CC2)c(Cl)cc1F |
| InChI | InChI=1S/C18H26ClFO/c1-11-9-14(15(19)10-16(11)20)17(21)12-5-7-13(8-6-12)18(2,3)4/h9-10,12-13,17,21H,5-8H2,1-4H3 |
| InChIKey | SUDDZRILSRASQB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |