C11H10BrCl2F3O — CID 103211447
1-bromo-2-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-5-fluorobenzene (PubChem CID 103211447) has the molecular formula C11H10BrCl2F3O and a molecular weight of 366.00 g/mol. Its IUPAC name is 1-bromo-2-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-5-fluorobenzene.
| Compound Name | 1-bromo-2-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-5-fluorobenzene |
|---|---|
| PubChem CID | 103211447 |
| Molecular Formula | C11H10BrCl2F3O |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 1-bromo-2-chloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]-5-fluorobenzene |
| SMILES | Fc1cc(Br)c(Cl)cc1C(Cl)CCOCC(F)F |
| InChI | InChI=1S/C11H10BrCl2F3O/c12-7-4-10(15)6(3-9(7)14)8(13)1-2-18-5-11(16)17/h3-4,8,11H,1-2,5H2 |
| InChIKey | ICCKPJAGEPSBHM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|