C12H8Br3ClFNS — CID 107961395
1-(4-bromo-5-chloro-2-fluorophenyl)-1-(2,5-dibromothiophen-3-yl)-N-methylmethanamine (PubChem CID 107961395) has the molecular formula C12H8Br3ClFNS and a molecular weight of 492.43 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(2,5-dibromothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(2,5-dibromothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107961395 |
| Molecular Formula | C12H8Br3ClFNS |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 488.76 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-1-(2,5-dibromothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Cl)c(Br)cc1F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H8Br3ClFNS/c1-18-11(6-3-10(14)19-12(6)15)5-2-8(16)7(13)4-9(5)17/h2-4,11,18H,1H3 |
| InChIKey | IUKHLFRPOHZAIY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|