C14H10BrClFNS2 — CID 105398856
1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-thieno[3,2-b]thiophen-5-ylmethanamine (PubChem CID 105398856) has the molecular formula C14H10BrClFNS2 and a molecular weight of 390.73 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-thieno[3,2-b]thiophen-5-ylmethanamine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-thieno[3,2-b]thiophen-5-ylmethanamine |
|---|---|
| PubChem CID | 105398856 |
| Molecular Formula | C14H10BrClFNS2 |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-thieno[3,2-b]thiophen-5-ylmethanamine |
| SMILES | CNC(c1cc2sccc2s1)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C14H10BrClFNS2/c1-18-14(7-4-9(16)8(15)5-10(7)17)13-6-12-11(20-13)2-3-19-12/h2-6,14,18H,1H3 |
| InChIKey | ZBDAHVYIQFKZIA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|