C11H5Br3ClFOS — CID 107964399
(4-bromo-5-chloro-2-fluorophenyl)-(2,5-dibromothiophen-3-yl)methanol (PubChem CID 107964399) has the molecular formula C11H5Br3ClFOS and a molecular weight of 479.39 g/mol. Its IUPAC name is (4-bromo-5-chloro-2-fluorophenyl)-(2,5-dibromothiophen-3-yl)methanol.
| Compound Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,5-dibromothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 107964399 |
| Molecular Formula | C11H5Br3ClFOS |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 475.73 |
| IUPAC Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,5-dibromothiophen-3-yl)methanol |
| SMILES | OC(c1cc(Cl)c(Br)cc1F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H5Br3ClFOS/c12-6-3-8(16)4(1-7(6)15)10(17)5-2-9(13)18-11(5)14/h1-3,10,17H |
| InChIKey | LOQDGIRXTSJTBL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|