C11H5BrCl2F2OS — CID 107964287
(4-bromo-2,5-difluorophenyl)-(2,5-dichlorothiophen-3-yl)methanol (PubChem CID 107964287) has the molecular formula C11H5BrCl2F2OS and a molecular weight of 374.03 g/mol. Its IUPAC name is (4-bromo-2,5-difluorophenyl)-(2,5-dichlorothiophen-3-yl)methanol.
| Compound Name | (4-bromo-2,5-difluorophenyl)-(2,5-dichlorothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 107964287 |
| Molecular Formula | C11H5BrCl2F2OS |
| Molecular Weight | 374.03 g/mol |
| Exact Mass | 371.86 |
| IUPAC Name | (4-bromo-2,5-difluorophenyl)-(2,5-dichlorothiophen-3-yl)methanol |
| SMILES | OC(c1cc(F)c(Br)cc1F)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H5BrCl2F2OS/c12-6-3-7(15)4(1-8(6)16)10(17)5-2-9(13)18-11(5)14/h1-3,10,17H |
| InChIKey | HUYDYPDOLFAFRT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.03 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|