C13H7BrClF3O — CID 81264627
(4-bromo-2,5-difluorophenyl)-(3-chloro-2-fluorophenyl)methanol (PubChem CID 81264627) has the molecular formula C13H7BrClF3O and a molecular weight of 351.55 g/mol. Its IUPAC name is (4-bromo-2,5-difluorophenyl)-(3-chloro-2-fluorophenyl)methanol.
| Compound Name | (4-bromo-2,5-difluorophenyl)-(3-chloro-2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 81264627 |
| Molecular Formula | C13H7BrClF3O |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | (4-bromo-2,5-difluorophenyl)-(3-chloro-2-fluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(Br)cc1F)c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H7BrClF3O/c14-8-5-10(16)7(4-11(8)17)13(19)6-2-1-3-9(15)12(6)18/h1-5,13,19H |
| InChIKey | KKALFEXPSMUFLX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|