C12H8Br2F3NS — CID 107961434
1-(2,5-dibromothiophen-3-yl)-N-methyl-1-(2,4,5-trifluorophenyl)methanamine (PubChem CID 107961434) has the molecular formula C12H8Br2F3NS and a molecular weight of 415.07 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-N-methyl-1-(2,4,5-trifluorophenyl)methanamine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-N-methyl-1-(2,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 107961434 |
| Molecular Formula | C12H8Br2F3NS |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 412.87 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-N-methyl-1-(2,4,5-trifluorophenyl)methanamine |
| SMILES | CNC(c1cc(F)c(F)cc1F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H8Br2F3NS/c1-18-11(6-3-10(13)19-12(6)14)5-2-8(16)9(17)4-7(5)15/h2-4,11,18H,1H3 |
| InChIKey | GEIHZROVZDVZNC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|