C12H14BrClFN — CID 107001430
(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanamine (PubChem CID 107001430) has the molecular formula C12H14BrClFN and a molecular weight of 306.61 g/mol. Its IUPAC name is (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanamine.
| Compound Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 107001430 |
| Molecular Formula | C12H14BrClFN |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methanamine |
| SMILES | CC1(C)CC1C(N)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C12H14BrClFN/c1-12(2)5-7(12)11(16)6-3-9(14)8(13)4-10(6)15/h3-4,7,11H,5,16H2,1-2H3 |
| InChIKey | LCBCZYZQQHALDI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|