C18H20ClF — CID 107182393
1-[chloro-(2,2-dimethylcyclopentyl)methyl]-4-fluoronaphthalene (PubChem CID 107182393) has the molecular formula C18H20ClF and a molecular weight of 290.81 g/mol. Its IUPAC name is 1-[chloro-(2,2-dimethylcyclopentyl)methyl]-4-fluoronaphthalene.
| Compound Name | 1-[chloro-(2,2-dimethylcyclopentyl)methyl]-4-fluoronaphthalene |
|---|---|
| PubChem CID | 107182393 |
| Molecular Formula | C18H20ClF |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[chloro-(2,2-dimethylcyclopentyl)methyl]-4-fluoronaphthalene |
| SMILES | CC1(C)CCCC1C(Cl)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C18H20ClF/c1-18(2)11-5-8-15(18)17(19)14-9-10-16(20)13-7-4-3-6-12(13)14/h3-4,6-7,9-10,15,17H,5,8,11H2,1-2H3 |
| InChIKey | GNZWLLGKUHRWMY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|