C15H19BrCl2O — CID 107181907
1-bromo-5-chloro-3-[chloro-(2,2-dimethylcyclopentyl)methyl]-2-methoxybenzene (PubChem CID 107181907) has the molecular formula C15H19BrCl2O and a molecular weight of 366.13 g/mol. Its IUPAC name is 1-bromo-5-chloro-3-[chloro-(2,2-dimethylcyclopentyl)methyl]-2-methoxybenzene.
| Compound Name | 1-bromo-5-chloro-3-[chloro-(2,2-dimethylcyclopentyl)methyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 107181907 |
| Molecular Formula | C15H19BrCl2O |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-bromo-5-chloro-3-[chloro-(2,2-dimethylcyclopentyl)methyl]-2-methoxybenzene |
| SMILES | COc1c(Br)cc(Cl)cc1C(Cl)C1CCCC1(C)C |
| InChI | InChI=1S/C15H19BrCl2O/c1-15(2)6-4-5-11(15)13(18)10-7-9(17)8-12(16)14(10)19-3/h7-8,11,13H,4-6H2,1-3H3 |
| InChIKey | MXNDUCFIBUFRKS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|