C17H24BrClO — CID 107182084
4-bromo-2-[chloro-(2,2-dimethylcyclohexyl)methyl]-1-ethoxybenzene (PubChem CID 107182084) has the molecular formula C17H24BrClO and a molecular weight of 359.74 g/mol. Its IUPAC name is 4-bromo-2-[chloro-(2,2-dimethylcyclohexyl)methyl]-1-ethoxybenzene.
| Compound Name | 4-bromo-2-[chloro-(2,2-dimethylcyclohexyl)methyl]-1-ethoxybenzene |
|---|---|
| PubChem CID | 107182084 |
| Molecular Formula | C17H24BrClO |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-bromo-2-[chloro-(2,2-dimethylcyclohexyl)methyl]-1-ethoxybenzene |
| SMILES | CCOc1ccc(Br)cc1C(Cl)C1CCCCC1(C)C |
| InChI | InChI=1S/C17H24BrClO/c1-4-20-15-9-8-12(18)11-13(15)16(19)14-7-5-6-10-17(14,2)3/h8-9,11,14,16H,4-7,10H2,1-3H3 |
| InChIKey | OAVDMUBGCYQRNQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|