C19H24O2 — CID 107181495
(2,2-dimethylcyclopentyl)-(4-methoxynaphthalen-1-yl)methanol (PubChem CID 107181495) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(4-methoxynaphthalen-1-yl)methanol.
| Compound Name | (2,2-dimethylcyclopentyl)-(4-methoxynaphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 107181495 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(4-methoxynaphthalen-1-yl)methanol |
| SMILES | COc1ccc(C(O)C2CCCC2(C)C)c2ccccc12 |
| InChI | InChI=1S/C19H24O2/c1-19(2)12-6-9-16(19)18(20)15-10-11-17(21-3)14-8-5-4-7-13(14)15/h4-5,7-8,10-11,16,18,20H,6,9,12H2,1-3H3 |
| InChIKey | PFICQAJOOZKOQZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |