C12H15ClO2 — CID 65420387
(5-chloro-2-methoxyphenyl)-(2-methylcyclopropyl)methanol (PubChem CID 65420387) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-(2-methylcyclopropyl)methanol.
| Compound Name | (5-chloro-2-methoxyphenyl)-(2-methylcyclopropyl)methanol |
|---|---|
| PubChem CID | 65420387 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-(2-methylcyclopropyl)methanol |
| SMILES | COc1ccc(Cl)cc1C(O)C1CC1C |
| InChI | InChI=1S/C12H15ClO2/c1-7-5-9(7)12(14)10-6-8(13)3-4-11(10)15-2/h3-4,6-7,9,12,14H,5H2,1-2H3 |
| InChIKey | GSOIYEDTNIMWSI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |