C12H15ClO4 — CID 103547438
1-(5-chloro-2-methoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanol (PubChem CID 103547438) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 103547438 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanol |
| SMILES | COc1ccc(Cl)cc1C(O)CC1OCCO1 |
| InChI | InChI=1S/C12H15ClO4/c1-15-11-3-2-8(13)6-9(11)10(14)7-12-16-4-5-17-12/h2-3,6,10,12,14H,4-5,7H2,1H3 |
| InChIKey | FNFFXYUJEZUOFH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |