C14H15Cl2F3O — CID 105093185
(2,3-dichlorophenyl)-[4-(trifluoromethyl)cyclohexyl]methanol (PubChem CID 105093185) has the molecular formula C14H15Cl2F3O and a molecular weight of 327.17 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[4-(trifluoromethyl)cyclohexyl]methanol.
| Compound Name | (2,3-dichlorophenyl)-[4-(trifluoromethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 105093185 |
| Molecular Formula | C14H15Cl2F3O |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2,3-dichlorophenyl)-[4-(trifluoromethyl)cyclohexyl]methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H15Cl2F3O/c15-11-3-1-2-10(12(11)16)13(20)8-4-6-9(7-5-8)14(17,18)19/h1-3,8-9,13,20H,4-7H2 |
| InChIKey | JDHAREYDCXNUHM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |