C10H16N2 — CID 66789754
(2,4,5-trimethylphenyl)methanediamine (PubChem CID 66789754) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2,4,5-trimethylphenyl)methanediamine.
| Compound Name | (2,4,5-trimethylphenyl)methanediamine |
|---|---|
| PubChem CID | 66789754 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2,4,5-trimethylphenyl)methanediamine |
| SMILES | Cc1cc(C)c(C(N)N)cc1C |
| InChI | InChI=1S/C10H16N2/c1-6-4-8(3)9(10(11)12)5-7(6)2/h4-5,10H,11-12H2,1-3H3 |
| InChIKey | BFUZAJJPGUEFDE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|