C11H18N2 — CID 96656268
[(1S)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine (PubChem CID 96656268) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is [(1S)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine.
| Compound Name | [(1S)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 96656268 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | [(1S)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(C)c([C@H](C)NN)cc1C |
| InChI | InChI=1S/C11H18N2/c1-7-5-9(3)11(6-8(7)2)10(4)13-12/h5-6,10,13H,12H2,1-4H3/t10-/m0/s1 |
| InChIKey | OLBMMVGDWFEHAA-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|