C11H15I — CID 142348913
1-(1-iodoethyl)-2,4,5-trimethylbenzene (PubChem CID 142348913) has the molecular formula C11H15I and a molecular weight of 274.15 g/mol. Its IUPAC name is 1-(1-iodoethyl)-2,4,5-trimethylbenzene.
| Compound Name | 1-(1-iodoethyl)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 142348913 |
| Molecular Formula | C11H15I |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(1-iodoethyl)-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(C)I)cc1C |
| InChI | InChI=1S/C11H15I/c1-7-5-9(3)11(10(4)12)6-8(7)2/h5-6,10H,1-4H3 |
| InChIKey | UUDRZUOBUSOVMN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|